C19H22NO2+ — CID 2200629
(3-methoxy-4-prop-2-ynoxyphenyl)methyl-[(1S)-1-phenylethyl]azanium (PubChem CID 2200629) has the molecular formula C19H22NO2+ and a molecular weight of 296.39 g/mol. Its IUPAC name is (3-methoxy-4-prop-2-ynoxyphenyl)methyl-[(1S)-1-phenylethyl]azanium.
| Compound Name | (3-methoxy-4-prop-2-ynoxyphenyl)methyl-[(1S)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 2200629 |
| Molecular Formula | C19H22NO2+ |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (3-methoxy-4-prop-2-ynoxyphenyl)methyl-[(1S)-1-phenylethyl]azanium |
| SMILES | C#CCOc1ccc(C[NH2+][C@@H](C)c2ccccc2)cc1OC |
| InChI | InChI=1S/C19H21NO2/c1-4-12-22-18-11-10-16(13-19(18)21-3)14-20-15(2)17-8-6-5-7-9-17/h1,5-11,13,15,20H,12,14H2,2-3H3/p+1/t15-/m0/s1 |
| InChIKey | DYQLYNQHPYWWJV-HNNXBMFYSA-O |
| XLogP | 2.53 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|