C21H23NO4S — CID 87258547
2-hydroxy-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]-3-phenylsulfanylpropanamide (PubChem CID 87258547) has the molecular formula C21H23NO4S and a molecular weight of 385.49 g/mol. Its IUPAC name is 2-hydroxy-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]-3-phenylsulfanylpropanamide.
| Compound Name | 2-hydroxy-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]-3-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 87258547 |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 2-hydroxy-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]-3-phenylsulfanylpropanamide |
| SMILES | C#CCOc1ccc(CCNC(=O)C(O)CSc2ccccc2)cc1OC |
| InChI | InChI=1S/C21H23NO4S/c1-3-13-26-19-10-9-16(14-20(19)25-2)11-12-22-21(24)18(23)15-27-17-7-5-4-6-8-17/h1,4-10,14,18,23H,11-13,15H2,2H3,(H,22,24) |
| InChIKey | YWXXURXBHAAVLA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|