C23H26ClNO4 — CID 87258708
(2S)-4-(4-chlorophenyl)-2-methoxy-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]butanamide (PubChem CID 87258708) has the molecular formula C23H26ClNO4 and a molecular weight of 415.92 g/mol. Its IUPAC name is (2S)-4-(4-chlorophenyl)-2-methoxy-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]butanamide.
| Compound Name | (2S)-4-(4-chlorophenyl)-2-methoxy-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 87258708 |
| Molecular Formula | C23H26ClNO4 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | (2S)-4-(4-chlorophenyl)-2-methoxy-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]butanamide |
| SMILES | C#CCOc1ccc(CCNC(=O)[C@H](CCc2ccc(Cl)cc2)OC)cc1OC |
| InChI | InChI=1S/C23H26ClNO4/c1-4-15-29-20-11-8-18(16-22(20)28-3)13-14-25-23(26)21(27-2)12-7-17-5-9-19(24)10-6-17/h1,5-6,8-11,16,21H,7,12-15H2,2-3H3,(H,25,26)/t21-/m0/s1 |
| InChIKey | AYORAHXKBNPMAB-NRFANRHFSA-N |
| XLogP | 3.67 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|