C21H22ClNO5 — CID 11750051
3-(4-chlorophenoxy)-2-hydroxy-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]propanamide (PubChem CID 11750051) has the molecular formula C21H22ClNO5 and a molecular weight of 403.86 g/mol. Its IUPAC name is 3-(4-chlorophenoxy)-2-hydroxy-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]propanamide.
| Compound Name | 3-(4-chlorophenoxy)-2-hydroxy-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 11750051 |
| Molecular Formula | C21H22ClNO5 |
| Molecular Weight | 403.86 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 3-(4-chlorophenoxy)-2-hydroxy-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]propanamide |
| SMILES | C#CCOc1ccc(CCNC(=O)C(O)COc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C21H22ClNO5/c1-3-12-27-19-9-4-15(13-20(19)26-2)10-11-23-21(25)18(24)14-28-17-7-5-16(22)6-8-17/h1,4-9,13,18,24H,10-12,14H2,2H3,(H,23,25) |
| InChIKey | LFXJSSOYVABECE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.86 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|