C17H21ClNO2+ — CID 7311517
(3-chloro-4,5-dimethoxyphenyl)methyl-[(1S)-1-phenylethyl]azanium (PubChem CID 7311517) has the molecular formula C17H21ClNO2+ and a molecular weight of 306.81 g/mol. Its IUPAC name is (3-chloro-4,5-dimethoxyphenyl)methyl-[(1S)-1-phenylethyl]azanium.
| Compound Name | (3-chloro-4,5-dimethoxyphenyl)methyl-[(1S)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 7311517 |
| Molecular Formula | C17H21ClNO2+ |
| Molecular Weight | 306.81 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (3-chloro-4,5-dimethoxyphenyl)methyl-[(1S)-1-phenylethyl]azanium |
| SMILES | COc1cc(C[NH2+][C@@H](C)c2ccccc2)cc(Cl)c1OC |
| InChI | InChI=1S/C17H20ClNO2/c1-12(14-7-5-4-6-8-14)19-11-13-9-15(18)17(21-3)16(10-13)20-2/h4-10,12,19H,11H2,1-3H3/p+1/t12-/m0/s1 |
| InChIKey | COQUEZINISKNBK-LBPRGKRZSA-O |
| XLogP | 3.18 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.81 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |