C23H23Cl2NO2 — CID 4715541
N-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-1-phenylethanamine (PubChem CID 4715541) has the molecular formula C23H23Cl2NO2 and a molecular weight of 416.35 g/mol. Its IUPAC name is N-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-1-phenylethanamine.
| Compound Name | N-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-1-phenylethanamine |
|---|---|
| PubChem CID | 4715541 |
| Molecular Formula | C23H23Cl2NO2 |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | N-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-1-phenylethanamine |
| SMILES | COc1cc(CNC(C)c2ccccc2)cc(Cl)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H23Cl2NO2/c1-16(19-6-4-3-5-7-19)26-14-18-12-21(25)23(22(13-18)27-2)28-15-17-8-10-20(24)11-9-17/h3-13,16,26H,14-15H2,1-2H3 |
| InChIKey | BZJFSRPLRXCFKI-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |