C26H29Cl2NO2 — CID 17155917
N-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-1-phenylbutan-1-amine (PubChem CID 17155917) has the molecular formula C26H29Cl2NO2 and a molecular weight of 458.43 g/mol. Its IUPAC name is N-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-1-phenylbutan-1-amine.
| Compound Name | N-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-1-phenylbutan-1-amine |
|---|---|
| PubChem CID | 17155917 |
| Molecular Formula | C26H29Cl2NO2 |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | N-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-1-phenylbutan-1-amine |
| SMILES | CCCC(NCc1cc(Cl)c(OCc2ccc(Cl)cc2)c(OCC)c1)c1ccccc1 |
| InChI | InChI=1S/C26H29Cl2NO2/c1-3-8-24(21-9-6-5-7-10-21)29-17-20-15-23(28)26(25(16-20)30-4-2)31-18-19-11-13-22(27)14-12-19/h5-7,9-16,24,29H,3-4,8,17-18H2,1-2H3 |
| InChIKey | MOMYNWWCHRHYMM-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |