C19H24ClNO5 — CID 110180890
(1-carboxy-2-phenylethyl)-[(3,4,5-trimethoxyphenyl)methyl]azanium chloride (PubChem CID 110180890) has the molecular formula C19H24ClNO5 and a molecular weight of 381.86 g/mol. Its IUPAC name is (1-carboxy-2-phenylethyl)-[(3,4,5-trimethoxyphenyl)methyl]azanium chloride.
| Compound Name | (1-carboxy-2-phenylethyl)-[(3,4,5-trimethoxyphenyl)methyl]azanium chloride |
|---|---|
| PubChem CID | 110180890 |
| Molecular Formula | C19H24ClNO5 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | (1-carboxy-2-phenylethyl)-[(3,4,5-trimethoxyphenyl)methyl]azanium chloride |
| SMILES | COc1cc(C[NH2+]C(Cc2ccccc2)C(=O)O)cc(OC)c1OC.[Cl-] |
| InChI | InChI=1S/C19H23NO5.ClH/c1-23-16-10-14(11-17(24-2)18(16)25-3)12-20-15(19(21)22)9-13-7-5-4-6-8-13;/h4-8,10-11,15,20H,9,12H2,1-3H3,(H,21,22);1H |
| InChIKey | LRCYVHNSNHEHAG-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 81.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |