C21H29NO4 — CID 123599375
1-[methyl(1-phenylpropan-2-yl)amino]-2-(3,4,5-trimethoxyphenyl)ethanol (PubChem CID 123599375) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is 1-[methyl(1-phenylpropan-2-yl)amino]-2-(3,4,5-trimethoxyphenyl)ethanol.
| Compound Name | 1-[methyl(1-phenylpropan-2-yl)amino]-2-(3,4,5-trimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 123599375 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 1-[methyl(1-phenylpropan-2-yl)amino]-2-(3,4,5-trimethoxyphenyl)ethanol |
| SMILES | COc1cc(CC(O)N(C)C(C)Cc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C21H29NO4/c1-15(11-16-9-7-6-8-10-16)22(2)20(23)14-17-12-18(24-3)21(26-5)19(13-17)25-4/h6-10,12-13,15,20,23H,11,14H2,1-5H3 |
| InChIKey | QIJRLTAZRZZBCK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|