C28H29ClO3P+ — CID 126958760
triphenyl-[(3,4,5-trimethoxyphenyl)methyl]phosphanium;hydrochloride (PubChem CID 126958760) has the molecular formula C28H29ClO3P+ and a molecular weight of 479.96 g/mol. Its IUPAC name is triphenyl-[(3,4,5-trimethoxyphenyl)methyl]phosphanium;hydrochloride.
| Compound Name | triphenyl-[(3,4,5-trimethoxyphenyl)methyl]phosphanium;hydrochloride |
|---|---|
| PubChem CID | 126958760 |
| Molecular Formula | C28H29ClO3P+ |
| Molecular Weight | 479.96 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | triphenyl-[(3,4,5-trimethoxyphenyl)methyl]phosphanium;hydrochloride |
| SMILES | COc1cc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C28H28O3P.ClH/c1-29-26-19-22(20-27(30-2)28(26)31-3)21-32(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25;/h4-20H,21H2,1-3H3;1H/q+1; |
| InChIKey | UKSISPKRRVBOOL-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.96 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|