C28H30ClO4P — CID 139062047
triphenyl-[(2,4,5-trimethoxyphenyl)methyl]phosphanium;chloride;hydrate (PubChem CID 139062047) has the molecular formula C28H30ClO4P and a molecular weight of 496.97 g/mol. Its IUPAC name is triphenyl-[(2,4,5-trimethoxyphenyl)methyl]phosphanium;chloride;hydrate.
| Compound Name | triphenyl-[(2,4,5-trimethoxyphenyl)methyl]phosphanium;chloride;hydrate |
|---|---|
| PubChem CID | 139062047 |
| Molecular Formula | C28H30ClO4P |
| Molecular Weight | 496.97 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | triphenyl-[(2,4,5-trimethoxyphenyl)methyl]phosphanium;chloride;hydrate |
| SMILES | COc1cc(OC)c(OC)cc1C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.O.[Cl-] |
| InChI | InChI=1S/C28H28O3P.ClH.H2O/c1-29-26-20-28(31-3)27(30-2)19-22(26)21-32(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25;;/h4-20H,21H2,1-3H3;1H;1H2/q+1;;/p-1 |
| InChIKey | DKNWWECADTWRKF-UHFFFAOYSA-M |
| XLogP | 1.39 |
| TPSA | 59.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.97 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|