C56H66N2O2P2+4 — CID 102355418
trimethyl-[3-[4-[3-(trimethylazaniumyl)propoxy]-2,5-bis(triphenylphosphaniumylmethyl)phenoxy]propyl]azanium (PubChem CID 102355418) has the molecular formula C56H66N2O2P2+4 and a molecular weight of 861.10 g/mol. Its IUPAC name is trimethyl-[3-[4-[3-(trimethylazaniumyl)propoxy]-2,5-bis(triphenylphosphaniumylmethyl)phenoxy]propyl]azanium.
| Compound Name | trimethyl-[3-[4-[3-(trimethylazaniumyl)propoxy]-2,5-bis(triphenylphosphaniumylmethyl)phenoxy]propyl]azanium |
|---|---|
| PubChem CID | 102355418 |
| Molecular Formula | C56H66N2O2P2+4 |
| Molecular Weight | 861.10 g/mol |
| Exact Mass | 860.46 |
| IUPAC Name | trimethyl-[3-[4-[3-(trimethylazaniumyl)propoxy]-2,5-bis(triphenylphosphaniumylmethyl)phenoxy]propyl]azanium |
| SMILES | C[N+](C)(C)CCCOc1cc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c(OCCC[N+](C)(C)C)cc1C[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C56H66N2O2P2/c1-57(2,3)39-25-41-59-55-43-48(46-62(52-33-19-10-20-34-52,53-35-21-11-22-36-53)54-37-23-12-24-38-54)56(60-42-26-40-58(4,5)6)44-47(55)45-61(49-27-13-7-14-28-49,50-29-15-8-16-30-50)51-31-17-9-18-32-51/h7-24,27-38,43-44H,25-26,39-42,45-46H2,1-6H3/q+4 |
| InChIKey | MUOOAYYIBSNYHV-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.10 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|