C44H36Br2I2P2 — CID 23655557
[2,5-diiodo-4-(triphenylphosphaniumylmethyl)phenyl]methyl-triphenylphosphanium dibromide (PubChem CID 23655557) has the molecular formula C44H36Br2I2P2 and a molecular weight of 1040.34 g/mol. Its IUPAC name is [2,5-diiodo-4-(triphenylphosphaniumylmethyl)phenyl]methyl-triphenylphosphanium dibromide.
| Compound Name | [2,5-diiodo-4-(triphenylphosphaniumylmethyl)phenyl]methyl-triphenylphosphanium dibromide |
|---|---|
| PubChem CID | 23655557 |
| Molecular Formula | C44H36Br2I2P2 |
| Molecular Weight | 1040.34 g/mol |
| Exact Mass | 1037.87 |
| IUPAC Name | [2,5-diiodo-4-(triphenylphosphaniumylmethyl)phenyl]methyl-triphenylphosphanium dibromide |
| SMILES | Ic1cc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c(I)cc1C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-].[Br-] |
| InChI | InChI=1S/C44H36I2P2.2BrH/c45-43-32-36(34-48(40-25-13-4-14-26-40,41-27-15-5-16-28-41)42-29-17-6-18-30-42)44(46)31-35(43)33-47(37-19-7-1-8-20-37,38-21-9-2-10-22-38)39-23-11-3-12-24-39;;/h1-32H,33-34H2;2*1H/q+2;;/p-2 |
| InChIKey | IDULGFWGAGVYMA-UHFFFAOYSA-L |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1040.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|