C29H30BrP — CID 87629549
(2,5-diethylphenyl)methyl-triphenylphosphanium bromide (PubChem CID 87629549) has the molecular formula C29H30BrP and a molecular weight of 489.44 g/mol. Its IUPAC name is (2,5-diethylphenyl)methyl-triphenylphosphanium bromide.
| Compound Name | (2,5-diethylphenyl)methyl-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 87629549 |
| Molecular Formula | C29H30BrP |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | (2,5-diethylphenyl)methyl-triphenylphosphanium bromide |
| SMILES | CCc1ccc(CC)c(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c1.[Br-] |
| InChI | InChI=1S/C29H30P.BrH/c1-3-24-20-21-25(4-2)26(22-24)23-30(27-14-8-5-9-15-27,28-16-10-6-11-17-28)29-18-12-7-13-19-29;/h5-22H,3-4,23H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | NECMRJDCTWAVDY-UHFFFAOYSA-M |
| XLogP | 3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|