C37H36N2O2P+ — CID 158311490
[3-[2-[(5-ethyl-2-hydroxyphenyl)methylideneamino]ethyliminomethyl]-4-hydroxyphenyl]methyl-triphenylphosphanium (PubChem CID 158311490) has the molecular formula C37H36N2O2P+ and a molecular weight of 571.68 g/mol. Its IUPAC name is [3-[2-[(5-ethyl-2-hydroxyphenyl)methylideneamino]ethyliminomethyl]-4-hydroxyphenyl]methyl-triphenylphosphanium.
| Compound Name | [3-[2-[(5-ethyl-2-hydroxyphenyl)methylideneamino]ethyliminomethyl]-4-hydroxyphenyl]methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 158311490 |
| Molecular Formula | C37H36N2O2P+ |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.25 |
| IUPAC Name | [3-[2-[(5-ethyl-2-hydroxyphenyl)methylideneamino]ethyliminomethyl]-4-hydroxyphenyl]methyl-triphenylphosphanium |
| SMILES | CCc1ccc(O)c(/C=N/CC/N=C/c2cc(C[P+](c3ccccc3)(c3ccccc3)c3ccccc3)ccc2O)c1 |
| InChI | InChI=1S/C37H35N2O2P/c1-2-29-18-20-36(40)31(24-29)26-38-22-23-39-27-32-25-30(19-21-37(32)41)28-42(33-12-6-3-7-13-33,34-14-8-4-9-15-34)35-16-10-5-11-17-35/h3-21,24-27H,2,22-23,28H2,1H3,(H-,38,39,40,41)/p+1 |
| InChIKey | YQQDRJDKFHUZMK-UHFFFAOYSA-O |
| XLogP | 6.69 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|