C23H28N2O2 — CID 137148214
4-ethyl-2-[[2-[(5-ethyl-2-hydroxyphenyl)methylideneamino]cyclopentyl]iminomethyl]phenol (PubChem CID 137148214) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 4-ethyl-2-[[2-[(5-ethyl-2-hydroxyphenyl)methylideneamino]cyclopentyl]iminomethyl]phenol.
| Compound Name | 4-ethyl-2-[[2-[(5-ethyl-2-hydroxyphenyl)methylideneamino]cyclopentyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 137148214 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 4-ethyl-2-[[2-[(5-ethyl-2-hydroxyphenyl)methylideneamino]cyclopentyl]iminomethyl]phenol |
| SMILES | CCc1ccc(O)c(/C=N/C2CCCC2/N=C/c2cc(CC)ccc2O)c1 |
| InChI | InChI=1S/C23H28N2O2/c1-3-16-8-10-22(26)18(12-16)14-24-20-6-5-7-21(20)25-15-19-13-17(4-2)9-11-23(19)27/h8-15,20-21,26-27H,3-7H2,1-2H3/b24-14+,25-15+ |
| InChIKey | KYLZKBDBHHEGDO-KOJZRSEWSA-N |
| XLogP | 4.68 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|