C20H22CuN2O2 — CID 135501676
copper;2-[[(1S,2S)-2-[(2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]phenol (PubChem CID 135501676) has the molecular formula C20H22CuN2O2 and a molecular weight of 385.95 g/mol. Its IUPAC name is copper;2-[[(1S,2S)-2-[(2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]phenol.
| Compound Name | copper;2-[[(1S,2S)-2-[(2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135501676 |
| Molecular Formula | C20H22CuN2O2 |
| Molecular Weight | 385.95 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | copper;2-[[(1S,2S)-2-[(2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]phenol |
| SMILES | Oc1ccccc1/C=N/[C@H]1CCCC[C@@H]1/N=C/c1ccccc1O.[Cu] |
| InChI | InChI=1S/C20H22N2O2.Cu/c23-19-11-5-1-7-15(19)13-21-17-9-3-4-10-18(17)22-14-16-8-2-6-12-20(16)24;/h1-2,5-8,11-14,17-18,23-24H,3-4,9-10H2;/b21-13+,22-14+;/t17-,18-;/m0./s1 |
| InChIKey | WNBXGEUGZYAYOY-CBTMCMSMSA-N |
| XLogP | 3.94 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.95 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|