C10H11NO — CID 5242286
2-(cyclopropyliminomethyl)phenol (PubChem CID 5242286) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is 2-(cyclopropyliminomethyl)phenol.
| Compound Name | 2-(cyclopropyliminomethyl)phenol |
|---|---|
| PubChem CID | 5242286 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 2-(cyclopropyliminomethyl)phenol |
| SMILES | Oc1ccccc1/C=N/C1CC1 |
| InChI | InChI=1S/C10H11NO/c12-10-4-2-1-3-8(10)7-11-9-5-6-9/h1-4,7,9,12H,5-6H2/b11-7+ |
| InChIKey | QTTGFXKYLVDEOB-YRNVUSSQSA-N |
| XLogP | 1.97 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|