C31H28N2O2 — CID 137159907
2-[[3-[(2-hydroxy-5-phenylphenyl)methylideneamino]cyclopentyl]iminomethyl]-4-phenylphenol (PubChem CID 137159907) has the molecular formula C31H28N2O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 2-[[3-[(2-hydroxy-5-phenylphenyl)methylideneamino]cyclopentyl]iminomethyl]-4-phenylphenol.
| Compound Name | 2-[[3-[(2-hydroxy-5-phenylphenyl)methylideneamino]cyclopentyl]iminomethyl]-4-phenylphenol |
|---|---|
| PubChem CID | 137159907 |
| Molecular Formula | C31H28N2O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 2-[[3-[(2-hydroxy-5-phenylphenyl)methylideneamino]cyclopentyl]iminomethyl]-4-phenylphenol |
| SMILES | Oc1ccc(-c2ccccc2)cc1/C=N/C1CCC(/N=C/c2cc(-c3ccccc3)ccc2O)C1 |
| InChI | InChI=1S/C31H28N2O2/c34-30-15-11-24(22-7-3-1-4-8-22)17-26(30)20-32-28-13-14-29(19-28)33-21-27-18-25(12-16-31(27)35)23-9-5-2-6-10-23/h1-12,15-18,20-21,28-29,34-35H,13-14,19H2/b32-20+,33-21+ |
| InChIKey | FFTDDZSUUHGPGD-YMQWWVFYSA-N |
| XLogP | 6.89 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|