C18H20BrN2O+ — CID 135598301
2-[[(3R)-1-benzylpyrrolidin-1-ium-3-yl]iminomethyl]-4-bromophenol (PubChem CID 135598301) has the molecular formula C18H20BrN2O+ and a molecular weight of 360.28 g/mol. Its IUPAC name is 2-[[(3R)-1-benzylpyrrolidin-1-ium-3-yl]iminomethyl]-4-bromophenol.
| Compound Name | 2-[[(3R)-1-benzylpyrrolidin-1-ium-3-yl]iminomethyl]-4-bromophenol |
|---|---|
| PubChem CID | 135598301 |
| Molecular Formula | C18H20BrN2O+ |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2-[[(3R)-1-benzylpyrrolidin-1-ium-3-yl]iminomethyl]-4-bromophenol |
| SMILES | Oc1ccc(Br)cc1/C=N/[C@@H]1CC[NH+](Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H19BrN2O/c19-16-6-7-18(22)15(10-16)11-20-17-8-9-21(13-17)12-14-4-2-1-3-5-14/h1-7,10-11,17,22H,8-9,12-13H2/p+1/b20-11+/t17-/m1/s1 |
| InChIKey | SHYXJWYNNNJLJQ-MLHZQLSASA-O |
| XLogP | 2.43 |
| TPSA | 37.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|