C15H21Br2N2O+ — CID 135847639
2,4-dibromo-6-[(1-propylpiperidin-1-ium-4-yl)iminomethyl]phenol (PubChem CID 135847639) has the molecular formula C15H21Br2N2O+ and a molecular weight of 405.15 g/mol. Its IUPAC name is 2,4-dibromo-6-[(1-propylpiperidin-1-ium-4-yl)iminomethyl]phenol.
| Compound Name | 2,4-dibromo-6-[(1-propylpiperidin-1-ium-4-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 135847639 |
| Molecular Formula | C15H21Br2N2O+ |
| Molecular Weight | 405.15 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | 2,4-dibromo-6-[(1-propylpiperidin-1-ium-4-yl)iminomethyl]phenol |
| SMILES | CCC[NH+]1CCC(/N=C/c2cc(Br)cc(Br)c2O)CC1 |
| InChI | InChI=1S/C15H20Br2N2O/c1-2-5-19-6-3-13(4-7-19)18-10-11-8-12(16)9-14(17)15(11)20/h8-10,13,20H,2-7H2,1H3/p+1/b18-10+ |
| InChIKey | PEVOUQKSHJXXTC-VCHYOVAHSA-O |
| XLogP | 2.79 |
| TPSA | 37.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.15 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|