C13H17Br2N2O2+ — CID 135595356
2,4-dibromo-6-(2-morpholin-4-ium-4-ylethyliminomethyl)phenol (PubChem CID 135595356) has the molecular formula C13H17Br2N2O2+ and a molecular weight of 393.10 g/mol. Its IUPAC name is 2,4-dibromo-6-(2-morpholin-4-ium-4-ylethyliminomethyl)phenol.
| Compound Name | 2,4-dibromo-6-(2-morpholin-4-ium-4-ylethyliminomethyl)phenol |
|---|---|
| PubChem CID | 135595356 |
| Molecular Formula | C13H17Br2N2O2+ |
| Molecular Weight | 393.10 g/mol |
| Exact Mass | 390.97 |
| IUPAC Name | 2,4-dibromo-6-(2-morpholin-4-ium-4-ylethyliminomethyl)phenol |
| SMILES | Oc1c(Br)cc(Br)cc1/C=N/CC[NH+]1CCOCC1 |
| InChI | InChI=1S/C13H16Br2N2O2/c14-11-7-10(13(18)12(15)8-11)9-16-1-2-17-3-5-19-6-4-17/h7-9,18H,1-6H2/p+1/b16-9+ |
| InChIKey | GTGHHHKSUZARNO-CXUHLZMHSA-O |
| XLogP | 1.25 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.10 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|