C18H15Br2F3N2O2 — CID 137172426
2,4-dibromo-6-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]iminomethyl]phenol (PubChem CID 137172426) has the molecular formula C18H15Br2F3N2O2 and a molecular weight of 508.13 g/mol. Its IUPAC name is 2,4-dibromo-6-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]iminomethyl]phenol.
| Compound Name | 2,4-dibromo-6-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 137172426 |
| Molecular Formula | C18H15Br2F3N2O2 |
| Molecular Weight | 508.13 g/mol |
| Exact Mass | 505.95 |
| IUPAC Name | 2,4-dibromo-6-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]iminomethyl]phenol |
| SMILES | Oc1c(Br)cc(Br)cc1/C=N/c1ccc(N2CCOCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C18H15Br2F3N2O2/c19-12-7-11(17(26)15(20)8-12)10-24-16-2-1-13(9-14(16)18(21,22)23)25-3-5-27-6-4-25/h1-2,7-10,26H,3-6H2/b24-10+ |
| InChIKey | PLCMVRCBZFCOBB-YSURURNPSA-N |
| XLogP | 5.52 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.13 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|