C19H18BrF3N2O3 — CID 3467831
4-bromo-2-methoxy-6-[[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]iminomethyl]phenol (PubChem CID 3467831) has the molecular formula C19H18BrF3N2O3 and a molecular weight of 459.26 g/mol. Its IUPAC name is 4-bromo-2-methoxy-6-[[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]iminomethyl]phenol.
| Compound Name | 4-bromo-2-methoxy-6-[[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 3467831 |
| Molecular Formula | C19H18BrF3N2O3 |
| Molecular Weight | 459.26 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | 4-bromo-2-methoxy-6-[[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]iminomethyl]phenol |
| SMILES | COc1cc(Br)cc(/C=N/c2cc(C(F)(F)F)ccc2N2CCOCC2)c1O |
| InChI | InChI=1S/C19H18BrF3N2O3/c1-27-17-10-14(20)8-12(18(17)26)11-24-15-9-13(19(21,22)23)2-3-16(15)25-4-6-28-7-5-25/h2-3,8-11,26H,4-7H2,1H3/b24-11+ |
| InChIKey | ZBYCWCNTPQCLPN-BHGWPJFGSA-N |
| XLogP | 4.77 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.26 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|