C15H11BrF3NO2 — CID 1377778
4-bromo-2-methoxy-6-[[3-(trifluoromethyl)phenyl]iminomethyl]phenol (PubChem CID 1377778) has the molecular formula C15H11BrF3NO2 and a molecular weight of 374.16 g/mol. Its IUPAC name is 4-bromo-2-methoxy-6-[[3-(trifluoromethyl)phenyl]iminomethyl]phenol.
| Compound Name | 4-bromo-2-methoxy-6-[[3-(trifluoromethyl)phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 1377778 |
| Molecular Formula | C15H11BrF3NO2 |
| Molecular Weight | 374.16 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | 4-bromo-2-methoxy-6-[[3-(trifluoromethyl)phenyl]iminomethyl]phenol |
| SMILES | COc1cc(Br)cc(/C=N/c2cccc(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C15H11BrF3NO2/c1-22-13-7-11(16)5-9(14(13)21)8-20-12-4-2-3-10(6-12)15(17,18)19/h2-8,21H,1H3/b20-8+ |
| InChIKey | ABXMVSRKEJYYIC-DNTJNYDQSA-N |
| XLogP | 4.93 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.16 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|