C17H16F3NO3 — CID 50885156
N-[3-(trifluoromethyl)phenyl]-1-(3,4,5-trimethoxyphenyl)methanimine (PubChem CID 50885156) has the molecular formula C17H16F3NO3 and a molecular weight of 339.31 g/mol. Its IUPAC name is N-[3-(trifluoromethyl)phenyl]-1-(3,4,5-trimethoxyphenyl)methanimine.
| Compound Name | N-[3-(trifluoromethyl)phenyl]-1-(3,4,5-trimethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 50885156 |
| Molecular Formula | C17H16F3NO3 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | N-[3-(trifluoromethyl)phenyl]-1-(3,4,5-trimethoxyphenyl)methanimine |
| SMILES | COc1cc(/C=N/c2cccc(C(F)(F)F)c2)cc(OC)c1OC |
| InChI | InChI=1S/C17H16F3NO3/c1-22-14-7-11(8-15(23-2)16(14)24-3)10-21-13-6-4-5-12(9-13)17(18,19)20/h4-10H,1-3H3/b21-10+ |
| InChIKey | DILIEPOYUYNWLZ-UFFVCSGVSA-N |
| XLogP | 4.48 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|