C15H16N2O3 — CID 23761418
1-pyridin-3-yl-N-(3,4,5-trimethoxyphenyl)methanimine (PubChem CID 23761418) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 1-pyridin-3-yl-N-(3,4,5-trimethoxyphenyl)methanimine.
| Compound Name | 1-pyridin-3-yl-N-(3,4,5-trimethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 23761418 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 1-pyridin-3-yl-N-(3,4,5-trimethoxyphenyl)methanimine |
| SMILES | COc1cc(/N=C/c2cccnc2)cc(OC)c1OC |
| InChI | InChI=1S/C15H16N2O3/c1-18-13-7-12(8-14(19-2)15(13)20-3)17-10-11-5-4-6-16-9-11/h4-10H,1-3H3/b17-10+ |
| InChIKey | HGUWLIBNHKDIMA-LICLKQGHSA-N |
| XLogP | 2.86 |
| TPSA | 52.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|