C14H15NO3 — CID 141070241
3-(3,4,5-trimethoxyphenyl)pyridine (PubChem CID 141070241) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 3-(3,4,5-trimethoxyphenyl)pyridine.
| Compound Name | 3-(3,4,5-trimethoxyphenyl)pyridine |
|---|---|
| PubChem CID | 141070241 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 3-(3,4,5-trimethoxyphenyl)pyridine |
| SMILES | COc1cc(-c2cccnc2)cc(OC)c1OC |
| InChI | InChI=1S/C14H15NO3/c1-16-12-7-11(10-5-4-6-15-9-10)8-13(17-2)14(12)18-3/h4-9H,1-3H3 |
| InChIKey | QRGBWOGOPNTNMT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |