C17H16N2O3S — CID 91111160
3-pyridin-3-yl-5-(3,4,5-trimethoxyphenyl)-1,2-thiazole (PubChem CID 91111160) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is 3-pyridin-3-yl-5-(3,4,5-trimethoxyphenyl)-1,2-thiazole.
| Compound Name | 3-pyridin-3-yl-5-(3,4,5-trimethoxyphenyl)-1,2-thiazole |
|---|---|
| PubChem CID | 91111160 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 3-pyridin-3-yl-5-(3,4,5-trimethoxyphenyl)-1,2-thiazole |
| SMILES | COc1cc(-c2cc(-c3cccnc3)ns2)cc(OC)c1OC |
| InChI | InChI=1S/C17H16N2O3S/c1-20-14-7-12(8-15(21-2)17(14)22-3)16-9-13(19-23-16)11-5-4-6-18-10-11/h4-10H,1-3H3 |
| InChIKey | UMLILDIOCJSZSH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |