C21H23NO6S — CID 91165486
5-(3,4-dimethoxyphenyl)-3-(2,3,4,5-tetramethoxyphenyl)-1,2-thiazole (PubChem CID 91165486) has the molecular formula C21H23NO6S and a molecular weight of 417.48 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-3-(2,3,4,5-tetramethoxyphenyl)-1,2-thiazole.
| Compound Name | 5-(3,4-dimethoxyphenyl)-3-(2,3,4,5-tetramethoxyphenyl)-1,2-thiazole |
|---|---|
| PubChem CID | 91165486 |
| Molecular Formula | C21H23NO6S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-3-(2,3,4,5-tetramethoxyphenyl)-1,2-thiazole |
| SMILES | COc1ccc(-c2cc(-c3cc(OC)c(OC)c(OC)c3OC)ns2)cc1OC |
| InChI | InChI=1S/C21H23NO6S/c1-23-15-8-7-12(9-16(15)24-2)18-11-14(22-29-18)13-10-17(25-3)20(27-5)21(28-6)19(13)26-4/h7-11H,1-6H3 |
| InChIKey | IYQUWBPNSVUWEB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 68.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |