C22H23NO5 — CID 90670581
5-(3,4-dimethoxyphenyl)-2-(3,4,5-trimethoxyphenyl)pyridine (PubChem CID 90670581) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-2-(3,4,5-trimethoxyphenyl)pyridine.
| Compound Name | 5-(3,4-dimethoxyphenyl)-2-(3,4,5-trimethoxyphenyl)pyridine |
|---|---|
| PubChem CID | 90670581 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-2-(3,4,5-trimethoxyphenyl)pyridine |
| SMILES | COc1ccc(-c2ccc(-c3cc(OC)c(OC)c(OC)c3)nc2)cc1OC |
| InChI | InChI=1S/C22H23NO5/c1-24-18-9-7-14(10-19(18)25-2)15-6-8-17(23-13-15)16-11-20(26-3)22(28-5)21(12-16)27-4/h6-13H,1-5H3 |
| InChIKey | OWBDWVSTYOJTOV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 59.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |