C16H21N3O3 — CID 20781185
N'-[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]ethane-1,2-diamine (PubChem CID 20781185) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is N'-[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]ethane-1,2-diamine.
| Compound Name | N'-[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 20781185 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | N'-[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]ethane-1,2-diamine |
| SMILES | COc1cc(-c2ccc(NCCN)cn2)cc(OC)c1OC |
| InChI | InChI=1S/C16H21N3O3/c1-20-14-8-11(9-15(21-2)16(14)22-3)13-5-4-12(10-19-13)18-7-6-17/h4-5,8-10,18H,6-7,17H2,1-3H3 |
| InChIKey | LYAQILISLZYHRT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 78.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |