C16H20N2O4 — CID 78851491
6-methoxy-N-[(3,4,5-trimethoxyphenyl)methyl]pyridin-3-amine (PubChem CID 78851491) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 6-methoxy-N-[(3,4,5-trimethoxyphenyl)methyl]pyridin-3-amine.
| Compound Name | 6-methoxy-N-[(3,4,5-trimethoxyphenyl)methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 78851491 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 6-methoxy-N-[(3,4,5-trimethoxyphenyl)methyl]pyridin-3-amine |
| SMILES | COc1ccc(NCc2cc(OC)c(OC)c(OC)c2)cn1 |
| InChI | InChI=1S/C16H20N2O4/c1-19-13-7-11(8-14(20-2)16(13)22-4)9-17-12-5-6-15(21-3)18-10-12/h5-8,10,17H,9H2,1-4H3 |
| InChIKey | KTOHXJYVGYRQMH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |