C14H16ClN3O3 — CID 171705192
5-chloro-N-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-amine (PubChem CID 171705192) has the molecular formula C14H16ClN3O3 and a molecular weight of 309.75 g/mol. Its IUPAC name is 5-chloro-N-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-amine.
| Compound Name | 5-chloro-N-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 171705192 |
| Molecular Formula | C14H16ClN3O3 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 5-chloro-N-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-amine |
| SMILES | COc1cc(CNc2ncc(Cl)cn2)cc(OC)c1OC |
| InChI | InChI=1S/C14H16ClN3O3/c1-19-11-4-9(5-12(20-2)13(11)21-3)6-16-14-17-7-10(15)8-18-14/h4-5,7-8H,6H2,1-3H3,(H,16,17,18) |
| InChIKey | IFZKVOVUHLGUFL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |