C18H23NO3 — CID 23880433
3,5-dimethyl-N-[(3,4,5-trimethoxyphenyl)methyl]aniline (PubChem CID 23880433) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 3,5-dimethyl-N-[(3,4,5-trimethoxyphenyl)methyl]aniline.
| Compound Name | 3,5-dimethyl-N-[(3,4,5-trimethoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 23880433 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 3,5-dimethyl-N-[(3,4,5-trimethoxyphenyl)methyl]aniline |
| SMILES | COc1cc(CNc2cc(C)cc(C)c2)cc(OC)c1OC |
| InChI | InChI=1S/C18H23NO3/c1-12-6-13(2)8-15(7-12)19-11-14-9-16(20-3)18(22-5)17(10-14)21-4/h6-10,19H,11H2,1-5H3 |
| InChIKey | IBEIKYQTGSZHKT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |