C11H17NO3 — CID 521855
N-methyl-1-(3,4,5-trimethoxyphenyl)methanamine (PubChem CID 521855) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is N-methyl-1-(3,4,5-trimethoxyphenyl)methanamine.
| Compound Name | N-methyl-1-(3,4,5-trimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 521855 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | N-methyl-1-(3,4,5-trimethoxyphenyl)methanamine |
| SMILES | CNCc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C11H17NO3/c1-12-7-8-5-9(13-2)11(15-4)10(6-8)14-3/h5-6,12H,7H2,1-4H3 |
| InChIKey | LFULMNRPABTDDQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |