C13H21NO5 — CID 82714412
N-(2-methoxyethoxy)-1-(3,4,5-trimethoxyphenyl)methanamine (PubChem CID 82714412) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is N-(2-methoxyethoxy)-1-(3,4,5-trimethoxyphenyl)methanamine.
| Compound Name | N-(2-methoxyethoxy)-1-(3,4,5-trimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 82714412 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N-(2-methoxyethoxy)-1-(3,4,5-trimethoxyphenyl)methanamine |
| SMILES | COCCONCc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C13H21NO5/c1-15-5-6-19-14-9-10-7-11(16-2)13(18-4)12(8-10)17-3/h7-8,14H,5-6,9H2,1-4H3 |
| InChIKey | UCIFFMBSECKAHB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|