C14H23NO5 — CID 17155563
2-[2-[(3,4,5-trimethoxyphenyl)methylamino]ethoxy]ethanol (PubChem CID 17155563) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is 2-[2-[(3,4,5-trimethoxyphenyl)methylamino]ethoxy]ethanol.
| Compound Name | 2-[2-[(3,4,5-trimethoxyphenyl)methylamino]ethoxy]ethanol |
|---|---|
| PubChem CID | 17155563 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 2-[2-[(3,4,5-trimethoxyphenyl)methylamino]ethoxy]ethanol |
| SMILES | COc1cc(CNCCOCCO)cc(OC)c1OC |
| InChI | InChI=1S/C14H23NO5/c1-17-12-8-11(9-13(18-2)14(12)19-3)10-15-4-6-20-7-5-16/h8-9,15-16H,4-7,10H2,1-3H3 |
| InChIKey | XEUHMAMKCJATME-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|