C13H21NO5 — CID 28727979
4-[[2-(2-hydroxyethoxy)ethylamino]methyl]-2,6-dimethoxyphenol (PubChem CID 28727979) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is 4-[[2-(2-hydroxyethoxy)ethylamino]methyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[[2-(2-hydroxyethoxy)ethylamino]methyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 28727979 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 4-[[2-(2-hydroxyethoxy)ethylamino]methyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(CNCCOCCO)cc(OC)c1O |
| InChI | InChI=1S/C13H21NO5/c1-17-11-7-10(8-12(18-2)13(11)16)9-14-3-5-19-6-4-15/h7-8,14-16H,3-6,9H2,1-2H3 |
| InChIKey | AOYULWLBKHXFIN-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|