C12H20ClNO3 — CID 45259502
2,6-dimethoxy-4-(propylaminomethyl)phenol;hydrochloride (PubChem CID 45259502) has the molecular formula C12H20ClNO3 and a molecular weight of 261.75 g/mol. Its IUPAC name is 2,6-dimethoxy-4-(propylaminomethyl)phenol;hydrochloride.
| Compound Name | 2,6-dimethoxy-4-(propylaminomethyl)phenol;hydrochloride |
|---|---|
| PubChem CID | 45259502 |
| Molecular Formula | C12H20ClNO3 |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2,6-dimethoxy-4-(propylaminomethyl)phenol;hydrochloride |
| SMILES | CCCNCc1cc(OC)c(O)c(OC)c1.Cl |
| InChI | InChI=1S/C12H19NO3.ClH/c1-4-5-13-8-9-6-10(15-2)12(14)11(7-9)16-3;/h6-7,13-14H,4-5,8H2,1-3H3;1H |
| InChIKey | SNVIWBNEFOWNNM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|