C14H23NO3 — CID 65369500
N-[[4-(ethoxymethoxy)-3-methoxyphenyl]methyl]propan-1-amine (PubChem CID 65369500) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is N-[[4-(ethoxymethoxy)-3-methoxyphenyl]methyl]propan-1-amine.
| Compound Name | N-[[4-(ethoxymethoxy)-3-methoxyphenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 65369500 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | N-[[4-(ethoxymethoxy)-3-methoxyphenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(OCOCC)c(OC)c1 |
| InChI | InChI=1S/C14H23NO3/c1-4-8-15-10-12-6-7-13(14(9-12)16-3)18-11-17-5-2/h6-7,9,15H,4-5,8,10-11H2,1-3H3 |
| InChIKey | COZVUSIDDXVQBG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|