C14H20F3NO3 — CID 106704541
N-[[4-methoxy-3-(2,2,2-trifluoroethoxymethoxy)phenyl]methyl]propan-1-amine (PubChem CID 106704541) has the molecular formula C14H20F3NO3 and a molecular weight of 307.31 g/mol. Its IUPAC name is N-[[4-methoxy-3-(2,2,2-trifluoroethoxymethoxy)phenyl]methyl]propan-1-amine.
| Compound Name | N-[[4-methoxy-3-(2,2,2-trifluoroethoxymethoxy)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 106704541 |
| Molecular Formula | C14H20F3NO3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | N-[[4-methoxy-3-(2,2,2-trifluoroethoxymethoxy)phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(OC)c(OCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C14H20F3NO3/c1-3-6-18-8-11-4-5-12(19-2)13(7-11)21-10-20-9-14(15,16)17/h4-5,7,18H,3,6,8-10H2,1-2H3 |
| InChIKey | AXMWNCPIVHVNPM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|