C14H19BrF3NO2 — CID 63047245
N-[[3-bromo-4-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]methyl]propan-1-amine (PubChem CID 63047245) has the molecular formula C14H19BrF3NO2 and a molecular weight of 370.21 g/mol. Its IUPAC name is N-[[3-bromo-4-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]methyl]propan-1-amine.
| Compound Name | N-[[3-bromo-4-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 63047245 |
| Molecular Formula | C14H19BrF3NO2 |
| Molecular Weight | 370.21 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | N-[[3-bromo-4-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(OCCOCC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C14H19BrF3NO2/c1-2-5-19-9-11-3-4-13(12(15)8-11)21-7-6-20-10-14(16,17)18/h3-4,8,19H,2,5-7,9-10H2,1H3 |
| InChIKey | RPJCOGXPQXJIRY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.21 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|