C13H16Br2F3NO2 — CID 107742281
N-[[3,5-dibromo-4-(2,2,2-trifluoroethoxymethoxy)phenyl]methyl]propan-1-amine (PubChem CID 107742281) has the molecular formula C13H16Br2F3NO2 and a molecular weight of 435.08 g/mol. Its IUPAC name is N-[[3,5-dibromo-4-(2,2,2-trifluoroethoxymethoxy)phenyl]methyl]propan-1-amine.
| Compound Name | N-[[3,5-dibromo-4-(2,2,2-trifluoroethoxymethoxy)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 107742281 |
| Molecular Formula | C13H16Br2F3NO2 |
| Molecular Weight | 435.08 g/mol |
| Exact Mass | 432.95 |
| IUPAC Name | N-[[3,5-dibromo-4-(2,2,2-trifluoroethoxymethoxy)phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(Br)c(OCOCC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C13H16Br2F3NO2/c1-2-3-19-6-9-4-10(14)12(11(15)5-9)21-8-20-7-13(16,17)18/h4-5,19H,2-3,6-8H2,1H3 |
| InChIKey | QMKPIJWLVXKNJX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.08 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|