C13H16Br2F3NO2 — CID 107742508
3-[2,6-dibromo-4-(propylaminomethyl)phenoxy]-1,1,1-trifluoropropan-2-ol (PubChem CID 107742508) has the molecular formula C13H16Br2F3NO2 and a molecular weight of 435.08 g/mol. Its IUPAC name is 3-[2,6-dibromo-4-(propylaminomethyl)phenoxy]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[2,6-dibromo-4-(propylaminomethyl)phenoxy]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 107742508 |
| Molecular Formula | C13H16Br2F3NO2 |
| Molecular Weight | 435.08 g/mol |
| Exact Mass | 432.95 |
| IUPAC Name | 3-[2,6-dibromo-4-(propylaminomethyl)phenoxy]-1,1,1-trifluoropropan-2-ol |
| SMILES | CCCNCc1cc(Br)c(OCC(O)C(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C13H16Br2F3NO2/c1-2-3-19-6-8-4-9(14)12(10(15)5-8)21-7-11(20)13(16,17)18/h4-5,11,19-20H,2-3,6-7H2,1H3 |
| InChIKey | IHBBJAPNXHYYEG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.08 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|