C13H17F4NO2 — CID 107687401
1,1,1-trifluoro-3-[2-fluoro-4-(propylaminomethyl)phenoxy]propan-2-ol (PubChem CID 107687401) has the molecular formula C13H17F4NO2 and a molecular weight of 295.28 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[2-fluoro-4-(propylaminomethyl)phenoxy]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[2-fluoro-4-(propylaminomethyl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 107687401 |
| Molecular Formula | C13H17F4NO2 |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 1,1,1-trifluoro-3-[2-fluoro-4-(propylaminomethyl)phenoxy]propan-2-ol |
| SMILES | CCCNCc1ccc(OCC(O)C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C13H17F4NO2/c1-2-5-18-7-9-3-4-11(10(14)6-9)20-8-12(19)13(15,16)17/h3-4,6,12,18-19H,2,5,7-8H2,1H3 |
| InChIKey | OVNXRKVTUQBSRM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|