C15H23FN2O2 — CID 107687356
2-[2-fluoro-4-(propylaminomethyl)phenoxy]-N-propan-2-ylacetamide (PubChem CID 107687356) has the molecular formula C15H23FN2O2 and a molecular weight of 282.36 g/mol. Its IUPAC name is 2-[2-fluoro-4-(propylaminomethyl)phenoxy]-N-propan-2-ylacetamide.
| Compound Name | 2-[2-fluoro-4-(propylaminomethyl)phenoxy]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 107687356 |
| Molecular Formula | C15H23FN2O2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 2-[2-fluoro-4-(propylaminomethyl)phenoxy]-N-propan-2-ylacetamide |
| SMILES | CCCNCc1ccc(OCC(=O)NC(C)C)c(F)c1 |
| InChI | InChI=1S/C15H23FN2O2/c1-4-7-17-9-12-5-6-14(13(16)8-12)20-10-15(19)18-11(2)3/h5-6,8,11,17H,4,7,9-10H2,1-3H3,(H,18,19) |
| InChIKey | LGBMGGABOWOFNY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|