C13H19FN2O2 — CID 107692678
2-[4-(2-aminoethyl)-2-fluorophenoxy]-N-propan-2-ylacetamide (PubChem CID 107692678) has the molecular formula C13H19FN2O2 and a molecular weight of 254.30 g/mol. Its IUPAC name is 2-[4-(2-aminoethyl)-2-fluorophenoxy]-N-propan-2-ylacetamide.
| Compound Name | 2-[4-(2-aminoethyl)-2-fluorophenoxy]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 107692678 |
| Molecular Formula | C13H19FN2O2 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 2-[4-(2-aminoethyl)-2-fluorophenoxy]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)COc1ccc(CCN)cc1F |
| InChI | InChI=1S/C13H19FN2O2/c1-9(2)16-13(17)8-18-12-4-3-10(5-6-15)7-11(12)14/h3-4,7,9H,5-6,8,15H2,1-2H3,(H,16,17) |
| InChIKey | JRYYBJDHRWDBFH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |