C13H17ClF3NO3 — CID 63899405
3-[2-chloro-4-[(2-methoxyethylamino)methyl]phenoxy]-1,1,1-trifluoropropan-2-ol (PubChem CID 63899405) has the molecular formula C13H17ClF3NO3 and a molecular weight of 327.73 g/mol. Its IUPAC name is 3-[2-chloro-4-[(2-methoxyethylamino)methyl]phenoxy]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[2-chloro-4-[(2-methoxyethylamino)methyl]phenoxy]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 63899405 |
| Molecular Formula | C13H17ClF3NO3 |
| Molecular Weight | 327.73 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 3-[2-chloro-4-[(2-methoxyethylamino)methyl]phenoxy]-1,1,1-trifluoropropan-2-ol |
| SMILES | COCCNCc1ccc(OCC(O)C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C13H17ClF3NO3/c1-20-5-4-18-7-9-2-3-11(10(14)6-9)21-8-12(19)13(15,16)17/h2-3,6,12,18-19H,4-5,7-8H2,1H3 |
| InChIKey | GICCTLBXDUZZNQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.73 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|