C14H20F3NO3 — CID 63320117
1-[4-[(2-methoxyethylamino)methyl]-2-(trifluoromethyl)phenoxy]propan-2-ol (PubChem CID 63320117) has the molecular formula C14H20F3NO3 and a molecular weight of 307.31 g/mol. Its IUPAC name is 1-[4-[(2-methoxyethylamino)methyl]-2-(trifluoromethyl)phenoxy]propan-2-ol.
| Compound Name | 1-[4-[(2-methoxyethylamino)methyl]-2-(trifluoromethyl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 63320117 |
| Molecular Formula | C14H20F3NO3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 1-[4-[(2-methoxyethylamino)methyl]-2-(trifluoromethyl)phenoxy]propan-2-ol |
| SMILES | COCCNCc1ccc(OCC(C)O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H20F3NO3/c1-10(19)9-21-13-4-3-11(8-18-5-6-20-2)7-12(13)14(15,16)17/h3-4,7,10,18-19H,5-6,8-9H2,1-2H3 |
| InChIKey | UZAKGNRKEZPFSK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|